Andre_Cpd_BRD32048.png

IUPAC: N-(4-methoxyphenyl)-6-(1-piperidinylmethyl)-1,3,5-triazine-2,4-diamine

Molecular Weight: 314.39

CLogP: 2.70

SMILES: COC1=CC=C(C=C1)NC2=NC(=NC(=N2)N)CN3CCCCC3

CAS No: 433694-46-3

KD: 17.1 ┬ÁM (SPR)

Citation: Mol. Cancer Ther.201413(6), 1492-502.

Commercial Sources: Cayman Chemical, ChemBridge Corporation (ID 6969847)