hedgehog_Robotnikinin.png

IUPAC: N-[(4-Chlorophenyl)methyl]-2-[(2R,6S,8E)-5,12-dioxo-2- phenyl-1-oxa-4-azacyclododec-8-en-6-yl]acetamide

Molecular Weight: 454.95

CLogP: 3.22

SMILES: O=C1[C@H](CC(NCC2=CC=C(Cl)C=C2)=O)C/C=C/CCC(O[C@@H](CN1)C3=CC=CC=C3)=O

CAS No: 1132653-79-2

KD: 3.1 ┬ÁM (SPR)

Citation: Nat. Chem. Biol.20095(3), 154-6.

Commercial Sources: Cayman ChemicalSanta Cruz Biotechnology