HDAC_BRD2577.png

IUPAC: N-(4-(2-((4-hydroxy-6-methylpyrimidin-2-yl)thio)acetyl)phenyl)acetamide

Molecular Weight: 317.36

CLogP: 2.45

SMILES: CC(NC1=CC=C(C(CSC2=NC(C)=CC(O)=N2)=O)C=C1)=O

CAS No: 353781-42-7

IC50: 11-74 ┬ÁM (fluorescence assay)

Citation: Bioorg. Med. Chem. Lett.201121(14), 4164-9

Commercial Sources: Ambinter, TimTec