Orai1_AnCoA4.png

IUPAC: 3-(6-methoxybenzo[d][1,3]dioxol-5-yl)-8,8-dimethyl-4H,8H-pyrano[2,3-f]chromen-4-one

Molecular Weight: 378.38

CLogP: 3.96

SMILES: CC1(C=CC2=C(O1)C=CC3=C2OC=C(C3=O)C4=CC5=C(C=C4OC)OCO5)C

CAS No: 24211-36-7

IC50 : 0.88 ┬ÁM (reporter assay)

Citation: Chem. Biol., 201421(10), 1278-92

Commercial Sources: Santa Cruz Biotechnology, Glixx Laboratories